From Wikipedia, the free encyclopedia
Pharmaceutical compound
1Fe-LSD |
|
| Other names | 1-(Ferrocenecarbonyl)-LSD; (8β)-1-Ferrocenecarbonyl-N,N-diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide; SYN-L-234 |
|---|
Routes of administration | Oral[1][2] |
|---|
| Drug class | Serotonergic psychedelic; Hallucinogen |
|---|
| ATC code | |
|---|
|
| CAS Number | |
|---|
|
| Formula | C31H33FeN3O2 |
|---|
| Molar mass | 535.469 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCN(C([C@H]1CN(C)[C@]2([H])Cc3c4c(C2=C1)cccc4n(C(c5ccc[cH-]5)=O)c3)=O)CC.c6[cH-]ccc6.[Fe+2]
|
InChI=InChI=1S/C26H28N3O2.C5H5.Fe/c1-4-28(5-2)25(30)19-13-21-20-11-8-12-22-24(20)18(14-23(21)27(3)15-19)16-29(22)26(31)17-9-6-7-10-17;1-2-4-5-3-1;/h6-13,16,19,23H,4-5,14-15H2,1-3H3;1-5H;/q2*-1;+2/t19-,23-;;/m1../s1 Key:IIOLYFVNUDARGZ-CHOFETAFSA-N
|
1Fe-LSD, also known as 1-(ferrocenecarbonyl)-LSD or as SYN-L-234, is a psychedelic drug of the lysergamide family related to lysergic acid diethylamide (LSD).[1][2][3] It is thought to be a prodrug of LSD.[1][2][3] The drug was patented by Lizard Labs in 2024.[3] Subsequently, it was encountered online as a novel designer drug being sold in Germany in November 2025.[1][2] 1Fe-LSD as the hemi-L-tartrate salt has been sold in the form of blotter containing 200 μg per tab and micropills containing 300 μg per pill.[1][2] 1Fe-LSD contains ferrocene, an iron compound, which is an orange organometallic compound and is assumed to result in the distinctive orange color of 1Fe-LSD blotter and pills.[1][2] 1Fe-LSD is not an explicitly controlled substance in the United States[4] or in Canada.[5]
- ^ a b c d e f "1Fe-LSD". AIPSIN (in Russian). Retrieved 1 January 2026.
- ^ a b c d e f Yurchenko R, Yurchenko L, Galetskaya I, Navitski M (November 2025). Psychoactive products market observation. Trend analysis. Recent trends in the identification of psychoactive substances. doi:10.13140/RG.2.2.17433.68969. Retrieved 1 January 2026.
- ^ a b c WO 2024/028495, Stratford A, Williamson JP, "Prodrugs of Substituted Ergolines", published 8 February 2024, assigned to Synex Holdings BV
- ^ Orange Book: List of Controlled Substances and Regulated Chemicals (January 2026) (PDF), United States: U.S. Department of Justice: Drug Enforcement Administration (DEA): Diversion Control Division, January 2026
- ^ "Controlled Drugs and Substances Act". Department of Justice Canada. 5 December 2025. Retrieved 20 January 2026.
|
|---|
| | No ring subs. | |
|---|
| 4-Hydroxytryptamines | |
|---|
| 5-Hydroxytryptamines | |
|---|
| 5-Methoxytryptamines | |
|---|
| Other ring subs. | |
|---|
| α-Alkyltryptamines | |
|---|
| Others | |
|---|
|
- Ergolines/lysergamides (e.g., LSD)
- Ibogalogs (e.g., ibogainalog, tabernanthalog)
- O-Methylnordehydrobufotenine
- Partial ergolines (e.g., NDTDI, RU-28306, CT-5252)
- Piperidinylethylindoles (e.g., pip-T)
- Pyrrolidinylethylindoles (e.g., pyr-T, 5-MeO-pyr-T)
- Pyrrolidinylmethylindoles (e.g., MPMI, 4-HO-MPMI (lucigenol), 5-MeO-MPMI, MSP-2020)
- Tetrahydropyridinylindoles (e.g., RU-28253 (5-MeO-THPI), NEtPhOH-THPI)
|
|---|
|
- Benzofurans (e.g., 5-MeO-DiBF (1-oxa-5-MeO-DiPT), dimemebfe (5-MeO-BFE; 1-oxa-5-MeO-DMT), mebfap (5-MeO-3-APB; 1-oxa-5-MeO-AMT))
- Benzothiophenes (e.g., 3-APBT (1-thia-AMT))
- Indazolethylamines (e.g., AL-38022A, O-methyl-AL-34662)
- Indenylethylamines (e.g., C-DMT)
- Isotryptamines (e.g., 6-MeO-isoDMT, Ro60-0175)
- MYCO-005
- Quinolinylethylamines (e.g., mefloquine)
|
|---|
|
|---|
| | |
|---|
|
- Others: 2C-B-AN
- 2C-DB
- 2C-G-x (e.g., 2C-G-3, 2C-G-5)
- β-Keto-2C-B (βk-2C-B)
- β-Keto-2C-I (βk-2C-I)
- β-Methyl-2C-B (BMB)
- (e.g., BOB, BOD, BOHB)
- (e.g., HOT-2, HOT-7, HOT-17)
- N-Ethyl-2C-B
- (e.g., 2CB-2-EtO, 2CD-2-EtO, 2CD-5-EtO, 2CE-5-EtO, 2CE-5iPrO, 2CT2-5-EtO, ASR-2001 (2CB-5-PrO))
|
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| Others |
- 25B-NAcPip
- 2-DM-DOM
- 4-HA
- 5-DM-DOM
- Benzofurans (e.g., 5-APB, 5-APDB, 6-APB, 6-APDB, F, F-2, F-22)
- Benzothiophenes (e.g., 5-APBT, 6-APBT)
- CT-5172
- DMAs (e.g., 2,4-DMA, 3,4-DMA)
- Fenfluramine
- MMA (3-MeO-4-MA)
- Norfenfluramine
- (e.g., 25D-NM-NDEAOP, DOB-NDEPA, DOI-NDEPA, DOM-NDEPA, DOTFM-NDEPA, M-NDEPA, TMA-2-NDEPA)
- PMA (4-MA)
- Thio-2Cs (e.g., 2C-5-TOET)
- Thio-DOx (e.g., 2-TOM, 5-TOET, 5-TOM, TOMSO)
- (e.g., TMA-3, TMA-4, TMA-5)
- ZDCM-04 (DOC-fenethylline)
|
|---|
|
- 1-Aminomethylindanes (e.g., 2CB-Ind, jimscaline)
- 2-Aminoindanes (e.g., DOM-AI)
- 3-Benzazepines (e.g., lorcaserin)
- 3-Phenylpiperidines (e.g., LPH-5, LPH-48)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- DMBMPP (juncosamine)
- Ergolines/lysergamides (e.g., LSD)
- Glaucine
- Partial ergolines (e.g., NDTDI, DEIMDHPCA, DEMPDHPCA, DEMTMPDHPCA, DEMNDHPCA)
- Phenylcyclopropylamines (e.g., DMCPA, TMT)
- Phenyloxazolamines (aminorexes) (e.g., 2C-B-aminorex)
- Pyridopyrroloquinoxalines (e.g., IHCH-7113)
- Z3517967757
- ZC-B
|
|---|
|
|---|
| |
|---|
| Others |
- Arylpiperazines (e.g., 2C-B-PP, 2-NP, mCPP, MK-212, ORG-12962, pCPP, pFPP, quipazine, TFMPP)
- Dihydrobenzoxazines (e.g., efavirenz)
- Phenoxyethylamines (e.g., CT-4719, ORG-37684)
- Pyridopyrroloquinoxalines (e.g., IHCH-7113)
- Quinazolinylethylamines (e.g., RH-34)
|
|---|
| Natural sources |
- Tryptamines: Acacia spp. (e.g., Acacia acuminata, Acacia confusa)
- Ayahuasca and vinho de Jurema (e.g., Psychotria viridis (chacruna), Dipolopterys cabrerana (chaliponga, chacruna), Mimosa tenuiflora (Mimosa hostilis; jurema))
- Brosimum (e.g., Brosimum acutifolium (takini))
- Hallucinogenic snuffs (e.g., Anadenanthera peregrina (yopo, jopo, cohoba, parica, ebene), Anadenanthera colubrina (vilca, cebil))
- Incilius alvarius (Bufo alvarius; Colorado River toad, Sonoran Desert toad; bufo)
- Psilocybin-containing mushrooms (magic mushrooms, shrooms) (e.g., Psilocybe cubensis, Psilocybe mexicana (teonanacatl))
- Lysergamides: Achnatherum robustum (sleepy grass)
- Epichloë spp.
- Ergot (Claviceps) (e.g., Claviceps purpurea, Claviceps paspali)
- Morning glory (Convolvulaceae) seeds (e.g., Ipomoea tricolor (tlitliltzin, badoh negro; Ipomoea violacea), Ipomoea corymbosa (coaxihuitl, ololiúqui; Rivea Corymbosa, Turbina Corymbosa), Argyreia nervosa (Hawaiian baby woodrose; HBWR))
- Periglandula spp. (e.g., Periglandula ipomoeae, Periglandula clandestina)
|
|---|
|